About N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide
N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide (PubChem CID 154118241) has the molecular formula C4H7N5O2
and a molecular weight of 157.13 g/mol. Its IUPAC name is N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide.
Molecular Properties
| Compound Name | N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide |
| PubChem CID | 154118241 |
| Molecular Formula | C4H7N5O2 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide |
| SMILES | CCc1n[nH]c(N[N+](=O)[O-])n1 |
| InChI | InChI=1S/C4H7N5O2/c1-2-3-5-4(7-6-3)8-9(10)11/h2H2,1H3,(H2,5,6,7,8) |
| InChIKey | SYXHTNYKJHFKRJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide?
The IUPAC name of N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide (CID 154118241) is N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide.
What is the SMILES notation for N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide?
The canonical SMILES for N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide is CCc1n[nH]c(N[N+](=O)[O-])n1.
What is the InChIKey of N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide?
The InChIKey is SYXHTNYKJHFKRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O2/c1-2-3-5-4(7-6-3)8-9(10)11/h2H2,1H3,(H2,5,6,7,8).
What are the key properties of N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide?
N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide has a molecular weight of 157.13 g/mol, XLogP of -0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethyl-1H-1,2,4-triazol-5-yl)nitramide is sourced from PubChem (CID 154118241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).