C12H14F3NO3S — CID 154120088
2-[3-(trifluoromethyl)phenyl]sulfonylpentanamide (PubChem CID 154120088) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]sulfonylpentanamide.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]sulfonylpentanamide |
|---|---|
| PubChem CID | 154120088 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]sulfonylpentanamide |
| SMILES | CCCC(C(N)=O)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3S/c1-2-4-10(11(16)17)20(18,19)9-6-3-5-8(7-9)12(13,14)15/h3,5-7,10H,2,4H2,1H3,(H2,16,17) |
| InChIKey | ARDBCMIKQKAZRS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |