C23H19Cl2FN4O2 — CID 154120645
8-chloro-1-[4-(2-chloro-3-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid (PubChem CID 154120645) has the molecular formula C23H19Cl2FN4O2 and a molecular weight of 473.34 g/mol. Its IUPAC name is 8-chloro-1-[4-(2-chloro-3-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid.
| Compound Name | 8-chloro-1-[4-(2-chloro-3-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid |
|---|---|
| PubChem CID | 154120645 |
| Molecular Formula | C23H19Cl2FN4O2 |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 8-chloro-1-[4-(2-chloro-3-fluorophenyl)cyclohex-3-en-1-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxylic acid |
| SMILES | O=C(O)N1Cc2cc(Cl)ccc2-n2c(nnc2C2CC=C(c3cccc(F)c3Cl)CC2)C1 |
| InChI | InChI=1S/C23H19Cl2FN4O2/c24-16-8-9-19-15(10-16)11-29(23(31)32)12-20-27-28-22(30(19)20)14-6-4-13(5-7-14)17-2-1-3-18(26)21(17)25/h1-4,8-10,14H,5-7,11-12H2,(H,31,32) |
| InChIKey | YPTPZQBWOTWKJK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |