C30H11Br5O — CID 154122200
2,3,4,5,6-pentabromo-2H-pyranthren-1-one (PubChem CID 154122200) has the molecular formula C30H11Br5O and a molecular weight of 786.94 g/mol. Its IUPAC name is 2,3,4,5,6-pentabromo-2H-pyranthren-1-one.
| Compound Name | 2,3,4,5,6-pentabromo-2H-pyranthren-1-one |
|---|---|
| PubChem CID | 154122200 |
| Molecular Formula | C30H11Br5O |
| Molecular Weight | 786.94 g/mol |
| Exact Mass | 781.67 |
| IUPAC Name | 2,3,4,5,6-pentabromo-2H-pyranthren-1-one |
| SMILES | O=C1c2cc3ccc4cc5c6ccccc6cc6cc(Br)c7c(Br)c(c2C(Br)=C(Br)C1Br)c3c4c7c65 |
| InChI | InChI=1S/C30H11Br5O/c31-18-10-14-7-11-3-1-2-4-15(11)16-8-12-5-6-13-9-17-22(27(33)28(34)29(35)30(17)36)25-21(13)20(12)24(19(14)16)23(18)26(25)32/h1-10,29H |
| InChIKey | JEVKTLOKAGPZLK-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.94 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|