C21H30N4O4S — CID 154123145
2-[[2-(2-methylsulfonyl-2,7-diazaspiro[3.4]octan-7-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 154123145) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-[[2-(2-methylsulfonyl-2,7-diazaspiro[3.4]octan-7-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-[[2-(2-methylsulfonyl-2,7-diazaspiro[3.4]octan-7-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 154123145 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[[2-(2-methylsulfonyl-2,7-diazaspiro[3.4]octan-7-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | CS(=O)(=O)N1CC2(CCN(c3ccccc3CN3CC4CN(C(=O)O)CC4C3)C2)C1 |
| InChI | InChI=1S/C21H30N4O4S/c1-30(28,29)25-14-21(15-25)6-7-23(13-21)19-5-3-2-4-16(19)8-22-9-17-11-24(20(26)27)12-18(17)10-22/h2-5,17-18H,6-15H2,1H3,(H,26,27) |
| InChIKey | UZGHEPVDGPTPRW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |