C15H20ClNO2 — CID 154124962
butyl 8-chloro-2,3,4,5-tetrahydro-1H-3-benzazepine-5-carboxylate (PubChem CID 154124962) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is butyl 8-chloro-2,3,4,5-tetrahydro-1H-3-benzazepine-5-carboxylate.
| Compound Name | butyl 8-chloro-2,3,4,5-tetrahydro-1H-3-benzazepine-5-carboxylate |
|---|---|
| PubChem CID | 154124962 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | butyl 8-chloro-2,3,4,5-tetrahydro-1H-3-benzazepine-5-carboxylate |
| SMILES | CCCCOC(=O)C1CNCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H20ClNO2/c1-2-3-8-19-15(18)14-10-17-7-6-11-9-12(16)4-5-13(11)14/h4-5,9,14,17H,2-3,6-8,10H2,1H3 |
| InChIKey | BBXGRZLJPVYHEG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|