C18H27N5 — CID 154125264
4-cyclohexyl-5,6-dimethyl-2-(pyridin-2-ylmethylimino)-1,3-dihydropyrimidin-4-amine (PubChem CID 154125264) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 4-cyclohexyl-5,6-dimethyl-2-(pyridin-2-ylmethylimino)-1,3-dihydropyrimidin-4-amine.
| Compound Name | 4-cyclohexyl-5,6-dimethyl-2-(pyridin-2-ylmethylimino)-1,3-dihydropyrimidin-4-amine |
|---|---|
| PubChem CID | 154125264 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 4-cyclohexyl-5,6-dimethyl-2-(pyridin-2-ylmethylimino)-1,3-dihydropyrimidin-4-amine |
| SMILES | CC1=C(C)C(N)(C2CCCCC2)N/C(=N/Cc2ccccn2)N1 |
| InChI | InChI=1S/C18H27N5/c1-13-14(2)22-17(21-12-16-10-6-7-11-20-16)23-18(13,19)15-8-4-3-5-9-15/h6-7,10-11,15H,3-5,8-9,12,19H2,1-2H3,(H2,21,22,23) |
| InChIKey | COTXRKILOAHIQX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|