C17H16N4O4S — CID 154128118
N-[4-[[3-(2-sulfamoylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenyl]acetamide (PubChem CID 154128118) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-[4-[[3-(2-sulfamoylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[3-(2-sulfamoylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 154128118 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[4-[[3-(2-sulfamoylphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Cc2nc(-c3ccccc3S(N)(=O)=O)no2)cc1 |
| InChI | InChI=1S/C17H16N4O4S/c1-11(22)19-13-8-6-12(7-9-13)10-16-20-17(21-25-16)14-4-2-3-5-15(14)26(18,23)24/h2-9H,10H2,1H3,(H,19,22)(H2,18,23,24) |
| InChIKey | OJFNARHQNXXKMI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |