C8H14O3 — CID 154128160
5,5-dimethoxy-3-methylpent-3-en-2-one (PubChem CID 154128160) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 5,5-dimethoxy-3-methylpent-3-en-2-one.
| Compound Name | 5,5-dimethoxy-3-methylpent-3-en-2-one |
|---|---|
| PubChem CID | 154128160 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 5,5-dimethoxy-3-methylpent-3-en-2-one |
| SMILES | COC(C=C(C)C(C)=O)OC |
| InChI | InChI=1S/C8H14O3/c1-6(7(2)9)5-8(10-3)11-4/h5,8H,1-4H3 |
| InChIKey | MXVNUXZQRXWKBU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|