C10H11N3S — CID 154128750
5-(3-aminothiophen-2-yl)benzene-1,3-diamine (PubChem CID 154128750) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 5-(3-aminothiophen-2-yl)benzene-1,3-diamine.
| Compound Name | 5-(3-aminothiophen-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 154128750 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-(3-aminothiophen-2-yl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(-c2sccc2N)c1 |
| InChI | InChI=1S/C10H11N3S/c11-7-3-6(4-8(12)5-7)10-9(13)1-2-14-10/h1-5H,11-13H2 |
| InChIKey | FJWRJLKEXUYBBV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|