About 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine
2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine (PubChem CID 154129046) has the molecular formula C11H24ClNS
and a molecular weight of 237.84 g/mol. Its IUPAC name is 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine.
Molecular Properties
| Compound Name | 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine |
| PubChem CID | 154129046 |
| Molecular Formula | C11H24ClNS |
| Molecular Weight | 237.84 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CC(Cl)CSCC |
| InChI | InChI=1S/C11H24ClNS/c1-4-7-13(8-5-2)9-11(12)10-14-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | JVPSQYCVDARKSD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine?
The IUPAC name of 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine (CID 154129046) is 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine.
What is the SMILES notation for 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine?
The canonical SMILES for 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine is CCCN(CCC)CC(Cl)CSCC.
What is the InChIKey of 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine?
The InChIKey is JVPSQYCVDARKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24ClNS/c1-4-7-13(8-5-2)9-11(12)10-14-6-3/h11H,4-10H2,1-3H3.
What are the key properties of 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine?
2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine has a molecular weight of 237.84 g/mol, XLogP of 3.47, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-ethylsulfanyl-N,N-dipropylpropan-1-amine is sourced from PubChem (CID 154129046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).