About CID 154130948
CID 154130948 (PubChem CID 154130948) has the molecular formula C10H14BO2
and a molecular weight of 177.03 g/mol.
Molecular Properties
| Compound Name | CID 154130948 |
| PubChem CID | 154130948 |
| Molecular Formula | C10H14BO2 |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | — |
| SMILES | CC12O[B]OC1=CC1CC2C1(C)C |
| InChI | InChI=1S/C10H14BO2/c1-9(2)6-4-7(9)10(3)8(5-6)12-11-13-10/h5-7H,4H2,1-3H3 |
| InChIKey | BVYBTEKPRHHUMW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 154130948 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154130948?
The IUPAC name of CID 154130948 (CID 154130948) is not available.
What is the SMILES notation for CID 154130948?
The canonical SMILES for CID 154130948 is CC12O[B]OC1=CC1CC2C1(C)C.
What is the InChIKey of CID 154130948?
The InChIKey is BVYBTEKPRHHUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BO2/c1-9(2)6-4-7(9)10(3)8(5-6)12-11-13-10/h5-7H,4H2,1-3H3.
What are the key properties of CID 154130948?
CID 154130948 has a molecular weight of 177.03 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154130948 is sourced from PubChem (CID 154130948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).