C9H3Cl4F2NS2 — CID 154131223
1-chloro-4-isothiocyanato-2-(2,2,2-trichloro-1,1-difluoroethyl)sulfanylbenzene (PubChem CID 154131223) has the molecular formula C9H3Cl4F2NS2 and a molecular weight of 369.07 g/mol. Its IUPAC name is 1-chloro-4-isothiocyanato-2-(2,2,2-trichloro-1,1-difluoroethyl)sulfanylbenzene.
| Compound Name | 1-chloro-4-isothiocyanato-2-(2,2,2-trichloro-1,1-difluoroethyl)sulfanylbenzene |
|---|---|
| PubChem CID | 154131223 |
| Molecular Formula | C9H3Cl4F2NS2 |
| Molecular Weight | 369.07 g/mol |
| Exact Mass | 366.84 |
| IUPAC Name | 1-chloro-4-isothiocyanato-2-(2,2,2-trichloro-1,1-difluoroethyl)sulfanylbenzene |
| SMILES | FC(F)(Sc1cc(N=C=S)ccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H3Cl4F2NS2/c10-6-2-1-5(16-4-17)3-7(6)18-9(14,15)8(11,12)13/h1-3H |
| InChIKey | REJBUGZLYSOXEF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.07 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|