C22H32Cl2O3 — CID 154136867
(8S,9S,10R,13S,14S,16R,17R)-17-acetyl-5,6-dichloro-17-hydroxy-10,13,16-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154136867) has the molecular formula C22H32Cl2O3 and a molecular weight of 415.40 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,16R,17R)-17-acetyl-5,6-dichloro-17-hydroxy-10,13,16-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,16R,17R)-17-acetyl-5,6-dichloro-17-hydroxy-10,13,16-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154136867 |
| Molecular Formula | C22H32Cl2O3 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (8S,9S,10R,13S,14S,16R,17R)-17-acetyl-5,6-dichloro-17-hydroxy-10,13,16-trimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(O)[C@H](C)C[C@H]2[C@@H]3CC(Cl)C4(Cl)CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C22H32Cl2O3/c1-12-9-17-15-10-18(23)21(24)11-14(26)5-7-19(21,3)16(15)6-8-20(17,4)22(12,27)13(2)25/h12,15-18,27H,5-11H2,1-4H3/t12-,15-,16+,17+,18?,19-,20+,21?,22+/m1/s1 |
| InChIKey | FCXQAQJAIVLTRM-CIKMDYANSA-N |
| XLogP | 4.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|