About dilithium;1-(phenoxy)ethoxybenzene
dilithium;1-(phenoxy)ethoxybenzene (PubChem CID 154137184) has the molecular formula C14H12Li2O2
and a molecular weight of 226.13 g/mol. Its IUPAC name is dilithium;1-(phenoxy)ethoxybenzene.
Molecular Properties
| Compound Name | dilithium;1-(phenoxy)ethoxybenzene |
| PubChem CID | 154137184 |
| Molecular Formula | C14H12Li2O2 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | dilithium;1-(phenoxy)ethoxybenzene |
| SMILES | CC(Oc1[c-]cccc1)Oc1[c-]cccc1.[Li+].[Li+] |
| InChI | InChI=1S/C14H12O2.2Li/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14;;/h2-8,10,12H,1H3;;/q-2;2*+1 |
| InChIKey | PNOJGSVKWNPLAV-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dilithium;1-(phenoxy)ethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;1-(phenoxy)ethoxybenzene?
The IUPAC name of dilithium;1-(phenoxy)ethoxybenzene (CID 154137184) is dilithium;1-(phenoxy)ethoxybenzene.
What is the SMILES notation for dilithium;1-(phenoxy)ethoxybenzene?
The canonical SMILES for dilithium;1-(phenoxy)ethoxybenzene is CC(Oc1[c-]cccc1)Oc1[c-]cccc1.[Li+].[Li+].
What is the InChIKey of dilithium;1-(phenoxy)ethoxybenzene?
The InChIKey is PNOJGSVKWNPLAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.2Li/c1-12(15-13-8-4-2-5-9-13)16-14-10-6-3-7-11-14;;/h2-8,10,12H,1H3;;/q-2;2*+1.
What are the key properties of dilithium;1-(phenoxy)ethoxybenzene?
dilithium;1-(phenoxy)ethoxybenzene has a molecular weight of 226.13 g/mol, XLogP of -2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;1-(phenoxy)ethoxybenzene is sourced from PubChem (CID 154137184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).