About trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane
trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane (PubChem CID 154137366) has the molecular formula C6H7Cl3F6Si
and a molecular weight of 327.56 g/mol. Its IUPAC name is trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane.
Molecular Properties
| Compound Name | trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane |
| PubChem CID | 154137366 |
| Molecular Formula | C6H7Cl3F6Si |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane |
| SMILES | FC(F)(F)CCC(C[Si](Cl)(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C6H7Cl3F6Si/c7-16(8,9)3-4(6(13,14)15)1-2-5(10,11)12/h4H,1-3H2 |
| InChIKey | RKTFPUDLLPMFMU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane?
The IUPAC name of trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane (CID 154137366) is trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane.
What is the SMILES notation for trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane?
The canonical SMILES for trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane is FC(F)(F)CCC(C[Si](Cl)(Cl)Cl)C(F)(F)F.
What is the InChIKey of trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane?
The InChIKey is RKTFPUDLLPMFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl3F6Si/c7-16(8,9)3-4(6(13,14)15)1-2-5(10,11)12/h4H,1-3H2.
What are the key properties of trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane?
trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane has a molecular weight of 327.56 g/mol, XLogP of 5.16, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]silane is sourced from PubChem (CID 154137366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).