C12H10N2O3S — CID 154137862
[2-(2-amino-1,3-thiazole-4-carbonyl)phenyl] acetate (PubChem CID 154137862) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is [2-(2-amino-1,3-thiazole-4-carbonyl)phenyl] acetate.
| Compound Name | [2-(2-amino-1,3-thiazole-4-carbonyl)phenyl] acetate |
|---|---|
| PubChem CID | 154137862 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | [2-(2-amino-1,3-thiazole-4-carbonyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)c1csc(N)n1 |
| InChI | InChI=1S/C12H10N2O3S/c1-7(15)17-10-5-3-2-4-8(10)11(16)9-6-18-12(13)14-9/h2-6H,1H3,(H2,13,14) |
| InChIKey | WGHABXLDALMXOA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|