About 4-(4-aminophenyl)-N,2,3-triethylaniline
4-(4-aminophenyl)-N,2,3-triethylaniline (PubChem CID 154138427) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N,2,3-triethylaniline.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-N,2,3-triethylaniline |
| PubChem CID | 154138427 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-(4-aminophenyl)-N,2,3-triethylaniline |
| SMILES | CCNc1ccc(-c2ccc(N)cc2)c(CC)c1CC |
| InChI | InChI=1S/C18H24N2/c1-4-15-16(5-2)18(20-6-3)12-11-17(15)13-7-9-14(19)10-8-13/h7-12,20H,4-6,19H2,1-3H3 |
| InChIKey | YBZIMAAISOEJKP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-N,2,3-triethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-N,2,3-triethylaniline?
The IUPAC name of 4-(4-aminophenyl)-N,2,3-triethylaniline (CID 154138427) is 4-(4-aminophenyl)-N,2,3-triethylaniline.
What is the SMILES notation for 4-(4-aminophenyl)-N,2,3-triethylaniline?
The canonical SMILES for 4-(4-aminophenyl)-N,2,3-triethylaniline is CCNc1ccc(-c2ccc(N)cc2)c(CC)c1CC.
What is the InChIKey of 4-(4-aminophenyl)-N,2,3-triethylaniline?
The InChIKey is YBZIMAAISOEJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2/c1-4-15-16(5-2)18(20-6-3)12-11-17(15)13-7-9-14(19)10-8-13/h7-12,20H,4-6,19H2,1-3H3.
What are the key properties of 4-(4-aminophenyl)-N,2,3-triethylaniline?
4-(4-aminophenyl)-N,2,3-triethylaniline has a molecular weight of 268.40 g/mol, XLogP of 4.49, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-N,2,3-triethylaniline is sourced from PubChem (CID 154138427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).