C14H13N5O2S — CID 154139923
2-[4-(ethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]isoindole-1,3-dione (PubChem CID 154139923) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-[4-(ethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-(ethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154139923 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[4-(ethylamino)-6-methylsulfanyl-1,3,5-triazin-2-yl]isoindole-1,3-dione |
| SMILES | CCNc1nc(SC)nc(N2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C14H13N5O2S/c1-3-15-12-16-13(18-14(17-12)22-2)19-10(20)8-6-4-5-7-9(8)11(19)21/h4-7H,3H2,1-2H3,(H,15,16,17,18) |
| InChIKey | XUZGQOQQDLTZCP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|