C26H32Si — CID 154141035
dimethyl-bis(2-propyl-1H-inden-1-yl)silane (PubChem CID 154141035) has the molecular formula C26H32Si and a molecular weight of 372.63 g/mol. Its IUPAC name is dimethyl-bis(2-propyl-1H-inden-1-yl)silane.
| Compound Name | dimethyl-bis(2-propyl-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 154141035 |
| Molecular Formula | C26H32Si |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | dimethyl-bis(2-propyl-1H-inden-1-yl)silane |
| SMILES | CCCC1=Cc2ccccc2C1[Si](C)(C)C1C(CCC)=Cc2ccccc21 |
| InChI | InChI=1S/C26H32Si/c1-5-11-21-17-19-13-7-9-15-23(19)25(21)27(3,4)26-22(12-6-2)18-20-14-8-10-16-24(20)26/h7-10,13-18,25-26H,5-6,11-12H2,1-4H3 |
| InChIKey | MHDQVFWKQCRSCQ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|