About N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide
N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide (PubChem CID 154143416) has the molecular formula C2H2F3N5O2
and a molecular weight of 185.06 g/mol. Its IUPAC name is N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide.
Molecular Properties
| Compound Name | N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide |
| PubChem CID | 154143416 |
| Molecular Formula | C2H2F3N5O2 |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide |
| SMILES | [N-]=[N+]=NN(O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C2H2F3N5O2/c3-2(4,5)1(11)7-10(12)9-8-6/h12H,(H,7,11) |
| InChIKey | QYSFFRUFTZIRBX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide?
The IUPAC name of N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide (CID 154143416) is N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide.
What is the SMILES notation for N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide?
The canonical SMILES for N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide is [N-]=[N+]=NN(O)NC(=O)C(F)(F)F.
What is the InChIKey of N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide?
The InChIKey is QYSFFRUFTZIRBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F3N5O2/c3-2(4,5)1(11)7-10(12)9-8-6/h12H,(H,7,11).
What are the key properties of N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide?
N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide has a molecular weight of 185.06 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-azido-2,2,2-trifluoro-N'-hydroxyacetohydrazide is sourced from PubChem (CID 154143416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).