About 4,5-diamino-2,3-diphenylphenol
4,5-diamino-2,3-diphenylphenol (PubChem CID 154143783) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 4,5-diamino-2,3-diphenylphenol.
Molecular Properties
| Compound Name | 4,5-diamino-2,3-diphenylphenol |
| PubChem CID | 154143783 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4,5-diamino-2,3-diphenylphenol |
| SMILES | Nc1cc(O)c(-c2ccccc2)c(-c2ccccc2)c1N |
| InChI | InChI=1S/C18H16N2O/c19-14-11-15(21)16(12-7-3-1-4-8-12)17(18(14)20)13-9-5-2-6-10-13/h1-11,21H,19-20H2 |
| InChIKey | GTLJHLJVYLMZQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diamino-2,3-diphenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diamino-2,3-diphenylphenol?
The IUPAC name of 4,5-diamino-2,3-diphenylphenol (CID 154143783) is 4,5-diamino-2,3-diphenylphenol.
What is the SMILES notation for 4,5-diamino-2,3-diphenylphenol?
The canonical SMILES for 4,5-diamino-2,3-diphenylphenol is Nc1cc(O)c(-c2ccccc2)c(-c2ccccc2)c1N.
What is the InChIKey of 4,5-diamino-2,3-diphenylphenol?
The InChIKey is GTLJHLJVYLMZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O/c19-14-11-15(21)16(12-7-3-1-4-8-12)17(18(14)20)13-9-5-2-6-10-13/h1-11,21H,19-20H2.
What are the key properties of 4,5-diamino-2,3-diphenylphenol?
4,5-diamino-2,3-diphenylphenol has a molecular weight of 276.34 g/mol, XLogP of 3.89, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diamino-2,3-diphenylphenol is sourced from PubChem (CID 154143783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).