C8H4F11N2+ — CID 154144091
1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-imidazol-1-ium (PubChem CID 154144091) has the molecular formula C8H4F11N2+ and a molecular weight of 337.11 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-imidazol-1-ium.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 154144091 |
| Molecular Formula | C8H4F11N2+ |
| Molecular Weight | 337.11 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1H-imidazol-1-ium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[NH+]1C=CN=C1 |
| InChI | InChI=1S/C8H3F11N2/c9-4(10,5(11,12)7(15,16)17)6(13,14)8(18,19)21-2-1-20-3-21/h1-3H/p+1 |
| InChIKey | VNIAYSSFROMNBU-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.11 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|