C12H15BrN4O2 — CID 154144989
2-bromo-5,6-dimethyl-3-(3-methylbut-2-enyl)imidazo[4,5-d]pyridazine-4,7-dione (PubChem CID 154144989) has the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 2-bromo-5,6-dimethyl-3-(3-methylbut-2-enyl)imidazo[4,5-d]pyridazine-4,7-dione.
| Compound Name | 2-bromo-5,6-dimethyl-3-(3-methylbut-2-enyl)imidazo[4,5-d]pyridazine-4,7-dione |
|---|---|
| PubChem CID | 154144989 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-bromo-5,6-dimethyl-3-(3-methylbut-2-enyl)imidazo[4,5-d]pyridazine-4,7-dione |
| SMILES | CC(C)=CCn1c(Br)nc2c(=O)n(C)n(C)c(=O)c21 |
| InChI | InChI=1S/C12H15BrN4O2/c1-7(2)5-6-17-9-8(14-12(17)13)10(18)15(3)16(4)11(9)19/h5H,6H2,1-4H3 |
| InChIKey | PTXILXQMTMEBEF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|