C12H19N5O3S — CID 154145679
(2R,3R,4R,5R)-5-(6-amino-2,6-dimethyl-8H-purin-9-yl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol (PubChem CID 154145679) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-amino-2,6-dimethyl-8H-purin-9-yl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-amino-2,6-dimethyl-8H-purin-9-yl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol |
|---|---|
| PubChem CID | 154145679 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-amino-2,6-dimethyl-8H-purin-9-yl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol |
| SMILES | CC1=NC(C)(N)C2=NCN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3S)C2=N1 |
| InChI | InChI=1S/C12H19N5O3S/c1-5-15-10-9(12(2,13)16-5)14-4-17(10)11-8(21)7(19)6(3-18)20-11/h6-8,11,18-19,21H,3-4,13H2,1-2H3/t6-,7-,8-,11-,12?/m1/s1 |
| InChIKey | UZCSFHQLNPUZQP-XRDACOTDSA-N |
| XLogP | -1.42 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|