C19H19N3O2 — CID 154146425
3,5-bis(4-ethoxyphenyl)-1,2,4-triazine (PubChem CID 154146425) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3,5-bis(4-ethoxyphenyl)-1,2,4-triazine.
| Compound Name | 3,5-bis(4-ethoxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 154146425 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3,5-bis(4-ethoxyphenyl)-1,2,4-triazine |
| SMILES | CCOc1ccc(-c2cnnc(-c3ccc(OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C19H19N3O2/c1-3-23-16-9-5-14(6-10-16)18-13-20-22-19(21-18)15-7-11-17(12-8-15)24-4-2/h5-13H,3-4H2,1-2H3 |
| InChIKey | PVWDWCBDJZYATH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |