About 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane
3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane (PubChem CID 154146559) has the molecular formula C12H13ClN2O2S
and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane.
Molecular Properties
| Compound Name | 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane |
| PubChem CID | 154146559 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane |
| SMILES | O=[N+]([O-])C(Cl)=C1SCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C12H13ClN2O2S/c13-11(15(16)17)12-14(7-4-8-18-12)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | DMJWWTCMZGZWKB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane?
The IUPAC name of 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane (CID 154146559) is 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane.
What is the SMILES notation for 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane?
The canonical SMILES for 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane is O=[N+]([O-])C(Cl)=C1SCCCN1Cc1ccccc1.
What is the InChIKey of 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane?
The InChIKey is DMJWWTCMZGZWKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2S/c13-11(15(16)17)12-14(7-4-8-18-12)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2.
What are the key properties of 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane?
3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane has a molecular weight of 284.77 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-[chloro(nitro)methylidene]-1,3-thiazinane is sourced from PubChem (CID 154146559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).