C23H37NO — CID 154147192
(8S,9S,10R,13S,14S,17R)-17-[2-(dimethylamino)ethenyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 154147192) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-[2-(dimethylamino)ethenyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-[2-(dimethylamino)ethenyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 154147192 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-[2-(dimethylamino)ethenyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CN(C)C=C[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H37NO/c1-22-13-10-21-19(20(22)8-6-16(22)11-14-24(3)4)7-5-17-15-18(25)9-12-23(17,21)2/h5,11,14,16,18-21,25H,6-10,12-13,15H2,1-4H3/t16-,18?,19+,20+,21+,22-,23+/m1/s1 |
| InChIKey | GFIMIHZVOGQSRW-OECSZWQISA-N |
| XLogP | 5.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|