C12H17N3O3S — CID 15414730
1,3-bis(prop-2-enyl)-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 15414730) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(prop-2-enyl)-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 15414730 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-5-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCCS)c1=O |
| InChI | InChI=1S/C12H17N3O3S/c1-3-6-13-10(16)14(7-4-2)12(18)15(11(13)17)8-5-9-19/h3-4,19H,1-2,5-9H2 |
| InChIKey | QRYHHIRNZGBOHR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|