About 4-pentyl-2-phenylphenol
4-pentyl-2-phenylphenol (PubChem CID 154147556) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is 4-pentyl-2-phenylphenol.
Molecular Properties
| Compound Name | 4-pentyl-2-phenylphenol |
| PubChem CID | 154147556 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-pentyl-2-phenylphenol |
| SMILES | CCCCCc1ccc(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C17H20O/c1-2-3-5-8-14-11-12-17(18)16(13-14)15-9-6-4-7-10-15/h4,6-7,9-13,18H,2-3,5,8H2,1H3 |
| InChIKey | LKHUSZRKORDICB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyl-2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyl-2-phenylphenol?
The IUPAC name of 4-pentyl-2-phenylphenol (CID 154147556) is 4-pentyl-2-phenylphenol.
What is the SMILES notation for 4-pentyl-2-phenylphenol?
The canonical SMILES for 4-pentyl-2-phenylphenol is CCCCCc1ccc(O)c(-c2ccccc2)c1.
What is the InChIKey of 4-pentyl-2-phenylphenol?
The InChIKey is LKHUSZRKORDICB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O/c1-2-3-5-8-14-11-12-17(18)16(13-14)15-9-6-4-7-10-15/h4,6-7,9-13,18H,2-3,5,8H2,1H3.
What are the key properties of 4-pentyl-2-phenylphenol?
4-pentyl-2-phenylphenol has a molecular weight of 240.35 g/mol, XLogP of 4.79, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyl-2-phenylphenol is sourced from PubChem (CID 154147556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).