C8H14F3N — CID 15414775
1,1,2-trifluoro-N,N,4-trimethylpent-1-en-3-amine (PubChem CID 15414775) has the molecular formula C8H14F3N and a molecular weight of 181.20 g/mol. Its IUPAC name is 1,1,2-trifluoro-N,N,4-trimethylpent-1-en-3-amine.
| Compound Name | 1,1,2-trifluoro-N,N,4-trimethylpent-1-en-3-amine |
|---|---|
| PubChem CID | 15414775 |
| Molecular Formula | C8H14F3N |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1,1,2-trifluoro-N,N,4-trimethylpent-1-en-3-amine |
| SMILES | CC(C)C(C(F)=C(F)F)N(C)C |
| InChI | InChI=1S/C8H14F3N/c1-5(2)7(12(3)4)6(9)8(10)11/h5,7H,1-4H3 |
| InChIKey | RCHSINHJSNTDNB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |