C29H37F7O — CID 154148861
9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2,3,3-heptafluorononan-4-ol (PubChem CID 154148861) has the molecular formula C29H37F7O and a molecular weight of 534.60 g/mol. Its IUPAC name is 9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2,3,3-heptafluorononan-4-ol.
| Compound Name | 9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2,3,3-heptafluorononan-4-ol |
|---|---|
| PubChem CID | 154148861 |
| Molecular Formula | C29H37F7O |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 9-[(8R,9S,13S,14R)-8-ethenyl-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-1,1,1,2,2,3,3-heptafluorononan-4-ol |
| SMILES | C=C[C@@]12CCc3cc(CCCCCC(O)C(F)(F)C(F)(F)C(F)(F)F)ccc3[C@H]1CC[C@]1(C)CCC[C@H]12 |
| InChI | InChI=1S/C29H37F7O/c1-3-26-17-13-20-18-19(11-12-21(20)22(26)14-16-25(2)15-7-9-23(25)26)8-5-4-6-10-24(37)27(30,31)28(32,33)29(34,35)36/h3,11-12,18,22-24,37H,1,4-10,13-17H2,2H3/t22-,23-,24?,25+,26-/m1/s1 |
| InChIKey | ULDVYAQYOSDISJ-CUGQGSCQSA-N |
| XLogP | 8.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|