C8H15NO — CID 154148870
1-(1,2,3,6-tetrahydropyridin-4-yl)propan-1-ol (PubChem CID 154148870) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-(1,2,3,6-tetrahydropyridin-4-yl)propan-1-ol.
| Compound Name | 1-(1,2,3,6-tetrahydropyridin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 154148870 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-(1,2,3,6-tetrahydropyridin-4-yl)propan-1-ol |
| SMILES | CCC(O)C1=CCNCC1 |
| InChI | InChI=1S/C8H15NO/c1-2-8(10)7-3-5-9-6-4-7/h3,8-10H,2,4-6H2,1H3 |
| InChIKey | PMZBZIUOVFAYCM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|