C12H11F16NO2 — CID 15414993
N,N-diethyl-1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanamine (PubChem CID 15414993) has the molecular formula C12H11F16NO2 and a molecular weight of 505.19 g/mol. Its IUPAC name is N,N-diethyl-1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanamine.
| Compound Name | N,N-diethyl-1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanamine |
|---|---|
| PubChem CID | 15414993 |
| Molecular Formula | C12H11F16NO2 |
| Molecular Weight | 505.19 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | N,N-diethyl-1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethanamine |
| SMILES | CCN(CC)C(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F16NO2/c1-3-29(4-2)6(14,15)5(13)30-12(27,28)8(18,10(22,23)24)31-11(25,26)7(16,17)9(19,20)21/h5H,3-4H2,1-2H3 |
| InChIKey | PFQYVMUDQLWOSK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.19 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|