C16H19F16NO2 — CID 15414994
N-butyl-N-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]butan-1-amine (PubChem CID 15414994) has the molecular formula C16H19F16NO2 and a molecular weight of 561.30 g/mol. Its IUPAC name is N-butyl-N-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]butan-1-amine.
| Compound Name | N-butyl-N-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]butan-1-amine |
|---|---|
| PubChem CID | 15414994 |
| Molecular Formula | C16H19F16NO2 |
| Molecular Weight | 561.30 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | N-butyl-N-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]butan-1-amine |
| SMILES | CCCCN(CCCC)C(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H19F16NO2/c1-3-5-7-33(8-6-4-2)10(18,19)9(17)34-16(31,32)12(22,14(26,27)28)35-15(29,30)11(20,21)13(23,24)25/h9H,3-8H2,1-2H3 |
| InChIKey | QZGJGJYZHJPWSD-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.30 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|