C12H9F16NO2 — CID 15414995
1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]pyrrolidine (PubChem CID 15414995) has the molecular formula C12H9F16NO2 and a molecular weight of 503.18 g/mol. Its IUPAC name is 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]pyrrolidine.
| Compound Name | 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 15414995 |
| Molecular Formula | C12H9F16NO2 |
| Molecular Weight | 503.18 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]pyrrolidine |
| SMILES | FC(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)N1CCCC1 |
| InChI | InChI=1S/C12H9F16NO2/c13-5(6(14,15)29-3-1-2-4-29)30-12(27,28)8(18,10(22,23)24)31-11(25,26)7(16,17)9(19,20)21/h5H,1-4H2 |
| InChIKey | MTZNTKTYMCTJER-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.18 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|