C13H11F16NO2 — CID 15414996
1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]piperidine (PubChem CID 15414996) has the molecular formula C13H11F16NO2 and a molecular weight of 517.20 g/mol. Its IUPAC name is 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]piperidine.
| Compound Name | 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 15414996 |
| Molecular Formula | C13H11F16NO2 |
| Molecular Weight | 517.20 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]piperidine |
| SMILES | FC(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C13H11F16NO2/c14-6(7(15,16)30-4-2-1-3-5-30)31-13(28,29)9(19,11(23,24)25)32-12(26,27)8(17,18)10(20,21)22/h6H,1-5H2 |
| InChIKey | FSZXYNAXZCCDFA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.20 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|