C21H26F2O3 — CID 154150086
(7R,8R,13S,14S)-7-(difluoromethyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one (PubChem CID 154150086) has the molecular formula C21H26F2O3 and a molecular weight of 364.43 g/mol. Its IUPAC name is (7R,8R,13S,14S)-7-(difluoromethyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one.
| Compound Name | (7R,8R,13S,14S)-7-(difluoromethyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
|---|---|
| PubChem CID | 154150086 |
| Molecular Formula | C21H26F2O3 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (7R,8R,13S,14S)-7-(difluoromethyl)-13-methylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-one |
| SMILES | C[C@]12CCC3=C4CCC5(C=C4C[C@@H](C(F)F)[C@H]3[C@@H]1CCC2=O)OCCO5 |
| InChI | InChI=1S/C21H26F2O3/c1-20-6-4-14-13-5-7-21(25-8-9-26-21)11-12(13)10-15(19(22)23)18(14)16(20)2-3-17(20)24/h11,15-16,18-19H,2-10H2,1H3/t15-,16+,18+,20+/m1/s1 |
| InChIKey | BXRQIBVDGGBSHS-JMVFIXPQSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |