C13H24N2 — CID 15415047
4-N,4-N-diethyl-1-N,1-N,5-trimethylhex-4-en-2-yne-1,4-diamine (PubChem CID 15415047) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N,1-N,5-trimethylhex-4-en-2-yne-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N,1-N,5-trimethylhex-4-en-2-yne-1,4-diamine |
|---|---|
| PubChem CID | 15415047 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 4-N,4-N-diethyl-1-N,1-N,5-trimethylhex-4-en-2-yne-1,4-diamine |
| SMILES | CCN(CC)C(C#CCN(C)C)=C(C)C |
| InChI | InChI=1S/C13H24N2/c1-7-15(8-2)13(12(3)4)10-9-11-14(5)6/h7-8,11H2,1-6H3 |
| InChIKey | WQEXYVLIBRKYCK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|