C11H14Cl2 — CID 154150593
1-(dichloromethyl)-2,3,4,5-tetramethylbenzene (PubChem CID 154150593) has the molecular formula C11H14Cl2 and a molecular weight of 217.14 g/mol. Its IUPAC name is 1-(dichloromethyl)-2,3,4,5-tetramethylbenzene.
| Compound Name | 1-(dichloromethyl)-2,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 154150593 |
| Molecular Formula | C11H14Cl2 |
| Molecular Weight | 217.14 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 1-(dichloromethyl)-2,3,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C(Cl)Cl)c(C)c(C)c1C |
| InChI | InChI=1S/C11H14Cl2/c1-6-5-10(11(12)13)9(4)8(3)7(6)2/h5,11H,1-4H3 |
| InChIKey | FZKQBXSRAKKKJQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|