About 3,5-diethoxyhexanal
3,5-diethoxyhexanal (PubChem CID 154151455) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3,5-diethoxyhexanal.
Molecular Properties
| Compound Name | 3,5-diethoxyhexanal |
| PubChem CID | 154151455 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 3,5-diethoxyhexanal |
| SMILES | CCOC(C)CC(CC=O)OCC |
| InChI | InChI=1S/C10H20O3/c1-4-12-9(3)8-10(6-7-11)13-5-2/h7,9-10H,4-6,8H2,1-3H3 |
| InChIKey | GOOAUHDBVNPSNP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diethoxyhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethoxyhexanal?
The IUPAC name of 3,5-diethoxyhexanal (CID 154151455) is 3,5-diethoxyhexanal.
What is the SMILES notation for 3,5-diethoxyhexanal?
The canonical SMILES for 3,5-diethoxyhexanal is CCOC(C)CC(CC=O)OCC.
What is the InChIKey of 3,5-diethoxyhexanal?
The InChIKey is GOOAUHDBVNPSNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-4-12-9(3)8-10(6-7-11)13-5-2/h7,9-10H,4-6,8H2,1-3H3.
What are the key properties of 3,5-diethoxyhexanal?
3,5-diethoxyhexanal has a molecular weight of 188.27 g/mol, XLogP of 1.80, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethoxyhexanal is sourced from PubChem (CID 154151455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).