About N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine
N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine (PubChem CID 154151474) has the molecular formula C22H52N2O4Si2
and a molecular weight of 464.84 g/mol. Its IUPAC name is N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine.
Molecular Properties
| Compound Name | N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine |
| PubChem CID | 154151474 |
| Molecular Formula | C22H52N2O4Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine |
| SMILES | CCO[SiH](OCC)C(C)CCNCCCCCCNCCC(C)[SiH](OCC)OCC |
| InChI | InChI=1S/C22H52N2O4Si2/c1-7-25-29(26-8-2)21(5)15-19-23-17-13-11-12-14-18-24-20-16-22(6)30(27-9-3)28-10-4/h21-24,29-30H,7-20H2,1-6H3 |
| InChIKey | MVORXBFXCFXXPF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine?
The IUPAC name of N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine (CID 154151474) is N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine.
What is the SMILES notation for N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine?
The canonical SMILES for N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine is CCO[SiH](OCC)C(C)CCNCCCCCCNCCC(C)[SiH](OCC)OCC.
What is the InChIKey of N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine?
The InChIKey is MVORXBFXCFXXPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H52N2O4Si2/c1-7-25-29(26-8-2)21(5)15-19-23-17-13-11-12-14-18-24-20-16-22(6)30(27-9-3)28-10-4/h21-24,29-30H,7-20H2,1-6H3.
What are the key properties of N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine?
N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine has a molecular weight of 464.84 g/mol, XLogP of 3.87, 23 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(3-diethoxysilylbutyl)hexane-1,6-diamine is sourced from PubChem (CID 154151474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).