C22H18F12NO3P — CID 15415249
ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)carbamate (PubChem CID 15415249) has the molecular formula C22H18F12NO3P and a molecular weight of 603.34 g/mol. Its IUPAC name is ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)carbamate.
| Compound Name | ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)carbamate |
|---|---|
| PubChem CID | 15415249 |
| Molecular Formula | C22H18F12NO3P |
| Molecular Weight | 603.34 g/mol |
| Exact Mass | 603.08 |
| IUPAC Name | ethyl N-(1-diphenylphosphoryl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)carbamate |
| SMILES | CCOC(=O)NC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18F12NO3P/c1-2-38-17(36)35-16(39(37,13-9-5-3-6-10-13)14-11-7-4-8-12-14)19(27,28)21(31,32)22(33,34)20(29,30)18(25,26)15(23)24/h3-12,15-16H,2H2,1H3,(H,35,36) |
| InChIKey | LJMZTHRSPPALBY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.34 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|