C10H8N4O — CID 154153724
5-oxido-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-ium (PubChem CID 154153724) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 5-oxido-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-ium.
| Compound Name | 5-oxido-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-ium |
|---|---|
| PubChem CID | 154153724 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 5-oxido-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-ium |
| SMILES | [O-][N+]1=Cc2ccccc2-n2cnnc2C1 |
| InChI | InChI=1S/C10H8N4O/c15-13-5-8-3-1-2-4-9(8)14-7-11-12-10(14)6-13/h1-5,7H,6H2 |
| InChIKey | TYCLCPMBFYXTIU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 56.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|