C17H29NSe — CID 15415997
(2S,3S)-3-ethenyl-2,3,7-trimethyl-1-pyrrolidin-1-yloct-6-ene-1-selone (PubChem CID 15415997) has the molecular formula C17H29NSe and a molecular weight of 326.39 g/mol. Its IUPAC name is (2S,3S)-3-ethenyl-2,3,7-trimethyl-1-pyrrolidin-1-yloct-6-ene-1-selone.
| Compound Name | (2S,3S)-3-ethenyl-2,3,7-trimethyl-1-pyrrolidin-1-yloct-6-ene-1-selone |
|---|---|
| PubChem CID | 15415997 |
| Molecular Formula | C17H29NSe |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2S,3S)-3-ethenyl-2,3,7-trimethyl-1-pyrrolidin-1-yloct-6-ene-1-selone |
| SMILES | C=C[C@](C)(CCC=C(C)C)[C@H](C)C(=[Se])N1CCCC1 |
| InChI | InChI=1S/C17H29NSe/c1-6-17(5,11-9-10-14(2)3)15(4)16(19)18-12-7-8-13-18/h6,10,15H,1,7-9,11-13H2,2-5H3/t15-,17-/m1/s1 |
| InChIKey | VAUGUYCNAXWJEQ-NVXWUHKLSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|