About 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine
1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine (PubChem CID 154160528) has the molecular formula C11H22N6
and a molecular weight of 238.34 g/mol. Its IUPAC name is 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine |
| PubChem CID | 154160528 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine |
| SMILES | Cn1nnnc1CCNC1CCCCC1(C)N |
| InChI | InChI=1S/C11H22N6/c1-11(12)7-4-3-5-9(11)13-8-6-10-14-15-16-17(10)2/h9,13H,3-8,12H2,1-2H3 |
| InChIKey | LGMJFWZSVSUDOJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine?
The IUPAC name of 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine (CID 154160528) is 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine.
What is the SMILES notation for 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine?
The canonical SMILES for 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine is Cn1nnnc1CCNC1CCCCC1(C)N.
What is the InChIKey of 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine?
The InChIKey is LGMJFWZSVSUDOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N6/c1-11(12)7-4-3-5-9(11)13-8-6-10-14-15-16-17(10)2/h9,13H,3-8,12H2,1-2H3.
What are the key properties of 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine?
1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine has a molecular weight of 238.34 g/mol, XLogP of 0.00, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-N-[2-(1-methyltetrazol-5-yl)ethyl]cyclohexane-1,2-diamine is sourced from PubChem (CID 154160528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).