About 18,18-diethylicos-9-enylhydrazine
18,18-diethylicos-9-enylhydrazine (PubChem CID 154160917) has the molecular formula C24H50N2
and a molecular weight of 366.68 g/mol. Its IUPAC name is 18,18-diethylicos-9-enylhydrazine.
Molecular Properties
| Compound Name | 18,18-diethylicos-9-enylhydrazine |
| PubChem CID | 154160917 |
| Molecular Formula | C24H50N2 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 366.40 |
| IUPAC Name | 18,18-diethylicos-9-enylhydrazine |
| SMILES | CCC(CC)(CC)CCCCCCCC=CCCCCCCCCNN |
| InChI | InChI=1S/C24H50N2/c1-4-24(5-2,6-3)22-20-18-16-14-12-10-8-7-9-11-13-15-17-19-21-23-26-25/h7-8,26H,4-6,9-23,25H2,1-3H3 |
| InChIKey | LJIDXHIDBKDVPR-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 18,18-diethylicos-9-enylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18,18-diethylicos-9-enylhydrazine?
The IUPAC name of 18,18-diethylicos-9-enylhydrazine (CID 154160917) is 18,18-diethylicos-9-enylhydrazine.
What is the SMILES notation for 18,18-diethylicos-9-enylhydrazine?
The canonical SMILES for 18,18-diethylicos-9-enylhydrazine is CCC(CC)(CC)CCCCCCCC=CCCCCCCCCNN.
What is the InChIKey of 18,18-diethylicos-9-enylhydrazine?
The InChIKey is LJIDXHIDBKDVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50N2/c1-4-24(5-2,6-3)22-20-18-16-14-12-10-8-7-9-11-13-15-17-19-21-23-26-25/h7-8,26H,4-6,9-23,25H2,1-3H3.
What are the key properties of 18,18-diethylicos-9-enylhydrazine?
18,18-diethylicos-9-enylhydrazine has a molecular weight of 366.68 g/mol, XLogP of 7.68, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 18,18-diethylicos-9-enylhydrazine is sourced from PubChem (CID 154160917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).