C28H42O5 — CID 154161643
3-octa-2,7-dienoxy-2,2-bis(octa-2,7-dienyl)butanedioic acid (PubChem CID 154161643) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is 3-octa-2,7-dienoxy-2,2-bis(octa-2,7-dienyl)butanedioic acid.
| Compound Name | 3-octa-2,7-dienoxy-2,2-bis(octa-2,7-dienyl)butanedioic acid |
|---|---|
| PubChem CID | 154161643 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 3-octa-2,7-dienoxy-2,2-bis(octa-2,7-dienyl)butanedioic acid |
| SMILES | C=CCCCC=CCOC(C(=O)O)C(CC=CCCCC=C)(CC=CCCCC=C)C(=O)O |
| InChI | InChI=1S/C28H42O5/c1-4-7-10-13-16-19-22-28(27(31)32,23-20-17-14-11-8-5-2)25(26(29)30)33-24-21-18-15-12-9-6-3/h4-6,16-21,25H,1-3,7-15,22-24H2,(H,29,30)(H,31,32) |
| InChIKey | BXHVHJICCHLBFU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|