About 2-sulfanyl-4H-1,2-benzothiazin-3-one
2-sulfanyl-4H-1,2-benzothiazin-3-one (PubChem CID 154161702) has the molecular formula C8H7NOS2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-sulfanyl-4H-1,2-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2-sulfanyl-4H-1,2-benzothiazin-3-one |
| PubChem CID | 154161702 |
| Molecular Formula | C8H7NOS2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 2-sulfanyl-4H-1,2-benzothiazin-3-one |
| SMILES | O=C1Cc2ccccc2SN1S |
| InChI | InChI=1S/C8H7NOS2/c10-8-5-6-3-1-2-4-7(6)12-9(8)11/h1-4,11H,5H2 |
| InChIKey | UDEKIHXDRVZHOY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-4H-1,2-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-4H-1,2-benzothiazin-3-one?
The IUPAC name of 2-sulfanyl-4H-1,2-benzothiazin-3-one (CID 154161702) is 2-sulfanyl-4H-1,2-benzothiazin-3-one.
What is the SMILES notation for 2-sulfanyl-4H-1,2-benzothiazin-3-one?
The canonical SMILES for 2-sulfanyl-4H-1,2-benzothiazin-3-one is O=C1Cc2ccccc2SN1S.
What is the InChIKey of 2-sulfanyl-4H-1,2-benzothiazin-3-one?
The InChIKey is UDEKIHXDRVZHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS2/c10-8-5-6-3-1-2-4-7(6)12-9(8)11/h1-4,11H,5H2.
What are the key properties of 2-sulfanyl-4H-1,2-benzothiazin-3-one?
2-sulfanyl-4H-1,2-benzothiazin-3-one has a molecular weight of 197.28 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-4H-1,2-benzothiazin-3-one is sourced from PubChem (CID 154161702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).