About 3H-azepine-2,4-diamine
3H-azepine-2,4-diamine (PubChem CID 154161880) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 3H-azepine-2,4-diamine.
Molecular Properties
| Compound Name | 3H-azepine-2,4-diamine |
| PubChem CID | 154161880 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 3H-azepine-2,4-diamine |
| SMILES | NC1=CC=CN=C(N)C1 |
| InChI | InChI=1S/C6H9N3/c7-5-2-1-3-9-6(8)4-5/h1-3H,4,7H2,(H2,8,9) |
| InChIKey | NZVMMYXAMNUWBZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3H-azepine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-azepine-2,4-diamine?
The IUPAC name of 3H-azepine-2,4-diamine (CID 154161880) is 3H-azepine-2,4-diamine.
What is the SMILES notation for 3H-azepine-2,4-diamine?
The canonical SMILES for 3H-azepine-2,4-diamine is NC1=CC=CN=C(N)C1.
What is the InChIKey of 3H-azepine-2,4-diamine?
The InChIKey is NZVMMYXAMNUWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c7-5-2-1-3-9-6(8)4-5/h1-3H,4,7H2,(H2,8,9).
What are the key properties of 3H-azepine-2,4-diamine?
3H-azepine-2,4-diamine has a molecular weight of 123.16 g/mol, XLogP of 0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-azepine-2,4-diamine is sourced from PubChem (CID 154161880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).